C11H20N2S2 — CID 82426303
N-[[4-methyl-2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]butan-1-amine (PubChem CID 82426303) has the molecular formula C11H20N2S2 and a molecular weight of 244.43 g/mol. Its IUPAC name is N-[[4-methyl-2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]butan-1-amine.
| Compound Name | N-[[4-methyl-2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 82426303 |
| Molecular Formula | C11H20N2S2 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N-[[4-methyl-2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1sc(CSC)nc1C |
| InChI | InChI=1S/C11H20N2S2/c1-4-5-6-12-7-10-9(2)13-11(15-10)8-14-3/h12H,4-8H2,1-3H3 |
| InChIKey | RYRIILOXBYDGLY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|