C14H20N4OS — CID 63814940
2-methoxy-N-[[3-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]ethanamine (PubChem CID 63814940) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-methoxy-N-[[3-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[3-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63814940 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-methoxy-N-[[3-methyl-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]ethanamine |
| SMILES | COCCNCc1ccc(Sc2n[nH]c(C)n2)c(C)c1 |
| InChI | InChI=1S/C14H20N4OS/c1-10-8-12(9-15-6-7-19-3)4-5-13(10)20-14-16-11(2)17-18-14/h4-5,8,15H,6-7,9H2,1-3H3,(H,16,17,18) |
| InChIKey | SUYUJSYUNJJADI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|