C13H17ClN4OS — CID 114864757
N-[[4-chloro-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine (PubChem CID 114864757) has the molecular formula C13H17ClN4OS and a molecular weight of 312.83 g/mol. Its IUPAC name is N-[[4-chloro-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[4-chloro-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 114864757 |
| Molecular Formula | C13H17ClN4OS |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[[4-chloro-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(Cl)cc1Sc1n[nH]c(C)n1 |
| InChI | InChI=1S/C13H17ClN4OS/c1-9-16-13(18-17-9)20-12-7-11(14)4-3-10(12)8-15-5-6-19-2/h3-4,7,15H,5-6,8H2,1-2H3,(H,16,17,18) |
| InChIKey | KRXYDZMSIMKWEW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|