C14H16ClNOS2 — CID 114863790
N-[(4-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]-2-methoxyethanamine (PubChem CID 114863790) has the molecular formula C14H16ClNOS2 and a molecular weight of 313.88 g/mol. Its IUPAC name is N-[(4-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(4-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 114863790 |
| Molecular Formula | C14H16ClNOS2 |
| Molecular Weight | 313.88 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-[(4-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(Cl)cc1Sc1cccs1 |
| InChI | InChI=1S/C14H16ClNOS2/c1-17-7-6-16-10-11-4-5-12(15)9-13(11)19-14-3-2-8-18-14/h2-5,8-9,16H,6-7,10H2,1H3 |
| InChIKey | XLNIXSMYWLDAMC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|