C12H18ClNOS — CID 114863829
N-[(4-chloro-2-ethylsulfanylphenyl)methyl]-2-methoxyethanamine (PubChem CID 114863829) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is N-[(4-chloro-2-ethylsulfanylphenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(4-chloro-2-ethylsulfanylphenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 114863829 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[(4-chloro-2-ethylsulfanylphenyl)methyl]-2-methoxyethanamine |
| SMILES | CCSc1cc(Cl)ccc1CNCCOC |
| InChI | InChI=1S/C12H18ClNOS/c1-3-16-12-8-11(13)5-4-10(12)9-14-6-7-15-2/h4-5,8,14H,3,6-7,9H2,1-2H3 |
| InChIKey | LWOQPBRRAGNUEO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|