C14H22ClNO2S — CID 114864971
3-[4-chloro-2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 114864971) has the molecular formula C14H22ClNO2S and a molecular weight of 303.86 g/mol. Its IUPAC name is 3-[4-chloro-2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[4-chloro-2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 114864971 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-[4-chloro-2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | COCCNCc1cc(Cl)ccc1SCC(C)CO |
| InChI | InChI=1S/C14H22ClNO2S/c1-11(9-17)10-19-14-4-3-13(15)7-12(14)8-16-5-6-18-2/h3-4,7,11,16-17H,5-6,8-10H2,1-2H3 |
| InChIKey | LUTGGWKJIUARPQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|