C13H15ClN2OS2 — CID 114864733
N-[[5-chloro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 114864733) has the molecular formula C13H15ClN2OS2 and a molecular weight of 314.86 g/mol. Its IUPAC name is N-[[5-chloro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-chloro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 114864733 |
| Molecular Formula | C13H15ClN2OS2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-[[5-chloro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Cl)ccc1Sc1nccs1 |
| InChI | InChI=1S/C13H15ClN2OS2/c1-17-6-4-15-9-10-8-11(14)2-3-12(10)19-13-16-5-7-18-13/h2-3,5,7-8,15H,4,6,9H2,1H3 |
| InChIKey | FETODNNMFIKWTM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|