C13H15BrN2S2 — CID 63814516
N-[[4-bromo-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 63814516) has the molecular formula C13H15BrN2S2 and a molecular weight of 343.32 g/mol. Its IUPAC name is N-[[4-bromo-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-bromo-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63814516 |
| Molecular Formula | C13H15BrN2S2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | N-[[4-bromo-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Br)cc1Sc1nccs1 |
| InChI | InChI=1S/C13H15BrN2S2/c1-2-5-15-9-10-3-4-11(14)8-12(10)18-13-16-6-7-17-13/h3-4,6-8,15H,2,5,9H2,1H3 |
| InChIKey | CYKYRPDPWMUWNO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|