C17H21BrN2S — CID 102926129
N-[[4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phenyl]methyl]propan-1-amine (PubChem CID 102926129) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is N-[[4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102926129 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[[4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Br)cc1Sc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C17H21BrN2S/c1-4-7-19-11-14-5-6-15(18)10-16(14)21-17-9-12(2)8-13(3)20-17/h5-6,8-10,19H,4,7,11H2,1-3H3 |
| InChIKey | CTYYULMZHQAZOZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|