C14H11BrN2S — CID 102924874
4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzonitrile (PubChem CID 102924874) has the molecular formula C14H11BrN2S and a molecular weight of 319.23 g/mol. Its IUPAC name is 4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzonitrile.
| Compound Name | 4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 102924874 |
| Molecular Formula | C14H11BrN2S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 4-bromo-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzonitrile |
| SMILES | Cc1cc(C)nc(Sc2cc(Br)ccc2C#N)c1 |
| InChI | InChI=1S/C14H11BrN2S/c1-9-5-10(2)17-14(6-9)18-13-7-12(15)4-3-11(13)8-16/h3-7H,1-2H3 |
| InChIKey | VOCRNTSJTHTUOU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |