C14H12ClNO2S — CID 102925985
3-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzoic acid (PubChem CID 102925985) has the molecular formula C14H12ClNO2S and a molecular weight of 293.78 g/mol. Its IUPAC name is 3-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzoic acid.
| Compound Name | 3-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 102925985 |
| Molecular Formula | C14H12ClNO2S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]benzoic acid |
| SMILES | Cc1cc(C)nc(Sc2ccc(C(=O)O)cc2Cl)c1 |
| InChI | InChI=1S/C14H12ClNO2S/c1-8-5-9(2)16-13(6-8)19-12-4-3-10(14(17)18)7-11(12)15/h3-7H,1-2H3,(H,17,18) |
| InChIKey | GGYJXDSXPLPAFH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |