C14H16ClNS2 — CID 114863797
N-[(5-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]propan-1-amine (PubChem CID 114863797) has the molecular formula C14H16ClNS2 and a molecular weight of 297.88 g/mol. Its IUPAC name is N-[(5-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114863797 |
| Molecular Formula | C14H16ClNS2 |
| Molecular Weight | 297.88 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[(5-chloro-2-thiophen-2-ylsulfanylphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Cl)ccc1Sc1cccs1 |
| InChI | InChI=1S/C14H16ClNS2/c1-2-7-16-10-11-9-12(15)5-6-13(11)18-14-4-3-8-17-14/h3-6,8-9,16H,2,7,10H2,1H3 |
| InChIKey | WNVGDXUDKUUUMG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|