C10H6Cl2S2 — CID 175549844
2-(2,4-dichlorophenyl)sulfanylthiophene (PubChem CID 175549844) has the molecular formula C10H6Cl2S2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)sulfanylthiophene.
| Compound Name | 2-(2,4-dichlorophenyl)sulfanylthiophene |
|---|---|
| PubChem CID | 175549844 |
| Molecular Formula | C10H6Cl2S2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 2-(2,4-dichlorophenyl)sulfanylthiophene |
| SMILES | Clc1ccc(Sc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2S2/c11-7-3-4-9(8(12)6-7)14-10-2-1-5-13-10/h1-6H |
| InChIKey | YCMHOJRJBWKAQY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |