C9H4Cl3NS2 — CID 102752219
2,3,5-trichloro-6-thiophen-2-ylsulfanylpyridine (PubChem CID 102752219) has the molecular formula C9H4Cl3NS2 and a molecular weight of 296.63 g/mol. Its IUPAC name is 2,3,5-trichloro-6-thiophen-2-ylsulfanylpyridine.
| Compound Name | 2,3,5-trichloro-6-thiophen-2-ylsulfanylpyridine |
|---|---|
| PubChem CID | 102752219 |
| Molecular Formula | C9H4Cl3NS2 |
| Molecular Weight | 296.63 g/mol |
| Exact Mass | 294.89 |
| IUPAC Name | 2,3,5-trichloro-6-thiophen-2-ylsulfanylpyridine |
| SMILES | Clc1cc(Cl)c(Sc2cccs2)nc1Cl |
| InChI | InChI=1S/C9H4Cl3NS2/c10-5-4-6(11)9(13-8(5)12)15-7-2-1-3-14-7/h1-4H |
| InChIKey | HXMBKCBXVFOYFP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|