C11H5Cl3FNS — CID 102752241
2,3,5-trichloro-6-(2-fluorophenyl)sulfanylpyridine (PubChem CID 102752241) has the molecular formula C11H5Cl3FNS and a molecular weight of 308.59 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(2-fluorophenyl)sulfanylpyridine.
| Compound Name | 2,3,5-trichloro-6-(2-fluorophenyl)sulfanylpyridine |
|---|---|
| PubChem CID | 102752241 |
| Molecular Formula | C11H5Cl3FNS |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.92 |
| IUPAC Name | 2,3,5-trichloro-6-(2-fluorophenyl)sulfanylpyridine |
| SMILES | Fc1ccccc1Sc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H5Cl3FNS/c12-6-5-7(13)11(16-10(6)14)17-9-4-2-1-3-8(9)15/h1-5H |
| InChIKey | ZQWPHCOGAVLHFL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|