C9H7Cl2N3S2 — CID 102763217
(3,5-dichloro-6-thiophen-2-ylsulfanyl-2-pyridinyl)hydrazine (PubChem CID 102763217) has the molecular formula C9H7Cl2N3S2 and a molecular weight of 292.22 g/mol. Its IUPAC name is (3,5-dichloro-6-thiophen-2-ylsulfanyl-2-pyridinyl)hydrazine.
| Compound Name | (3,5-dichloro-6-thiophen-2-ylsulfanyl-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 102763217 |
| Molecular Formula | C9H7Cl2N3S2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | (3,5-dichloro-6-thiophen-2-ylsulfanyl-2-pyridinyl)hydrazine |
| SMILES | NNc1nc(Sc2cccs2)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2N3S2/c10-5-4-6(11)9(13-8(5)14-12)16-7-2-1-3-15-7/h1-4H,12H2,(H,13,14) |
| InChIKey | DOWJTAGIUYPZIJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|