C13H16Cl2N4S — CID 102761807
3,5-dichloro-6-hydrazinyl-N-(1-thiophen-2-ylbutyl)pyridin-2-amine (PubChem CID 102761807) has the molecular formula C13H16Cl2N4S and a molecular weight of 331.27 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-(1-thiophen-2-ylbutyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-(1-thiophen-2-ylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102761807 |
| Molecular Formula | C13H16Cl2N4S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-(1-thiophen-2-ylbutyl)pyridin-2-amine |
| SMILES | CCCC(Nc1nc(NN)c(Cl)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C13H16Cl2N4S/c1-2-4-10(11-5-3-6-20-11)17-12-8(14)7-9(15)13(18-12)19-16/h3,5-7,10H,2,4,16H2,1H3,(H2,17,18,19) |
| InChIKey | VZWBTKPZWLLGMJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|