C14H19N3S — CID 66279967
5-methyl-2-N-(1-thiophen-2-ylbutyl)pyridine-2,3-diamine (PubChem CID 66279967) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-methyl-2-N-(1-thiophen-2-ylbutyl)pyridine-2,3-diamine.
| Compound Name | 5-methyl-2-N-(1-thiophen-2-ylbutyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 66279967 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-methyl-2-N-(1-thiophen-2-ylbutyl)pyridine-2,3-diamine |
| SMILES | CCCC(Nc1ncc(C)cc1N)c1cccs1 |
| InChI | InChI=1S/C14H19N3S/c1-3-5-12(13-6-4-7-18-13)17-14-11(15)8-10(2)9-16-14/h4,6-9,12H,3,5,15H2,1-2H3,(H,16,17) |
| InChIKey | SCBVBZQHCPYGSP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |