C14H20N4S — CID 80808300
2,5-dimethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine (PubChem CID 80808300) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 2,5-dimethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine.
| Compound Name | 2,5-dimethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80808300 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2,5-dimethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine |
| SMILES | CCCC(Nc1nc(C)nc(N)c1C)c1cccs1 |
| InChI | InChI=1S/C14H20N4S/c1-4-6-11(12-7-5-8-19-12)18-14-9(2)13(15)16-10(3)17-14/h5,7-8,11H,4,6H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | ZLNUTFYVXIPCMO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |