C15H20N4S — CID 80960729
2-cyclopropyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine (PubChem CID 80960729) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-cyclopropyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine.
| Compound Name | 2-cyclopropyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80960729 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-cyclopropyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-4,6-diamine |
| SMILES | CCCC(Nc1cc(N)nc(C2CC2)n1)c1cccs1 |
| InChI | InChI=1S/C15H20N4S/c1-2-4-11(12-5-3-8-20-12)17-14-9-13(16)18-15(19-14)10-6-7-10/h3,5,8-11H,2,4,6-7H2,1H3,(H3,16,17,18,19) |
| InChIKey | BOPDHVHNJJVOKC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |