C14H20N4S — CID 80807159
2-N-ethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-2,4-diamine (PubChem CID 80807159) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80807159 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-N-ethyl-4-N-(1-thiophen-2-ylbutyl)pyrimidine-2,4-diamine |
| SMILES | CCCC(Nc1ccnc(NCC)n1)c1cccs1 |
| InChI | InChI=1S/C14H20N4S/c1-3-6-11(12-7-5-10-19-12)17-13-8-9-16-14(18-13)15-4-2/h5,7-11H,3-4,6H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | PVLYLEVSEDIOJW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |