C15H22N4S — CID 105362540
5,6-diethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-triazin-3-amine (PubChem CID 105362540) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 5,6-diethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362540 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5,6-diethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-triazin-3-amine |
| SMILES | CCCC(Nc1nnc(CC)c(CC)n1)c1cccs1 |
| InChI | InChI=1S/C15H22N4S/c1-4-8-13(14-9-7-10-20-14)17-15-16-11(5-2)12(6-3)18-19-15/h7,9-10,13H,4-6,8H2,1-3H3,(H,16,17,19) |
| InChIKey | AQUGWDNUUBSMNV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |