C13H18N2S2 — CID 62961002
4-ethyl-N-(1-thiophen-2-ylbutyl)-1,3-thiazol-2-amine (PubChem CID 62961002) has the molecular formula C13H18N2S2 and a molecular weight of 266.44 g/mol. Its IUPAC name is 4-ethyl-N-(1-thiophen-2-ylbutyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(1-thiophen-2-ylbutyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62961002 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-ethyl-N-(1-thiophen-2-ylbutyl)-1,3-thiazol-2-amine |
| SMILES | CCCC(Nc1nc(CC)cs1)c1cccs1 |
| InChI | InChI=1S/C13H18N2S2/c1-3-6-11(12-7-5-8-16-12)15-13-14-10(4-2)9-17-13/h5,7-9,11H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | LNDQRKSJUAFDKA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |