C12H16N4S — CID 105362410
5,6-diethyl-N-(thiophen-2-ylmethyl)-1,2,4-triazin-3-amine (PubChem CID 105362410) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 5,6-diethyl-N-(thiophen-2-ylmethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(thiophen-2-ylmethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362410 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5,6-diethyl-N-(thiophen-2-ylmethyl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCc2cccs2)nc1CC |
| InChI | InChI=1S/C12H16N4S/c1-3-10-11(4-2)15-16-12(14-10)13-8-9-6-5-7-17-9/h5-7H,3-4,8H2,1-2H3,(H,13,14,16) |
| InChIKey | WGJQBONRNWAWKP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |