C11H16N6 — CID 114985339
5,6-diethyl-N-(1H-pyrazol-5-ylmethyl)-1,2,4-triazin-3-amine (PubChem CID 114985339) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 5,6-diethyl-N-(1H-pyrazol-5-ylmethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(1H-pyrazol-5-ylmethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114985339 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 5,6-diethyl-N-(1H-pyrazol-5-ylmethyl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCc2ccn[nH]2)nc1CC |
| InChI | InChI=1S/C11H16N6/c1-3-9-10(4-2)16-17-11(14-9)12-7-8-5-6-13-15-8/h5-6H,3-4,7H2,1-2H3,(H,13,15)(H,12,14,17) |
| InChIKey | NHWOPBHQJOZURS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |