C10H15N5 — CID 115898042
3-ethyl-1-methyl-N-(1H-pyrazol-5-ylmethyl)pyrazol-4-amine (PubChem CID 115898042) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is 3-ethyl-1-methyl-N-(1H-pyrazol-5-ylmethyl)pyrazol-4-amine.
| Compound Name | 3-ethyl-1-methyl-N-(1H-pyrazol-5-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 115898042 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-ethyl-1-methyl-N-(1H-pyrazol-5-ylmethyl)pyrazol-4-amine |
| SMILES | CCc1nn(C)cc1NCc1ccn[nH]1 |
| InChI | InChI=1S/C10H15N5/c1-3-9-10(7-15(2)14-9)11-6-8-4-5-12-13-8/h4-5,7,11H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | BPENTTSFJYBMEC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |