C11H16N4 — CID 115897990
3-ethyl-1-methyl-N-(1H-pyrrol-3-ylmethyl)pyrazol-4-amine (PubChem CID 115897990) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-ethyl-1-methyl-N-(1H-pyrrol-3-ylmethyl)pyrazol-4-amine.
| Compound Name | 3-ethyl-1-methyl-N-(1H-pyrrol-3-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 115897990 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-ethyl-1-methyl-N-(1H-pyrrol-3-ylmethyl)pyrazol-4-amine |
| SMILES | CCc1nn(C)cc1NCc1cc[nH]c1 |
| InChI | InChI=1S/C11H16N4/c1-3-10-11(8-15(2)14-10)13-7-9-4-5-12-6-9/h4-6,8,12-13H,3,7H2,1-2H3 |
| InChIKey | XMWBGCNBYARUPX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |