C12H19N7 — CID 105362674
5,6-diethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazin-3-amine (PubChem CID 105362674) has the molecular formula C12H19N7 and a molecular weight of 261.33 g/mol. Its IUPAC name is 5,6-diethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362674 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5,6-diethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCCCc2ncn[nH]2)nc1CC |
| InChI | InChI=1S/C12H19N7/c1-3-9-10(4-2)17-19-12(16-9)13-7-5-6-11-14-8-15-18-11/h8H,3-7H2,1-2H3,(H,13,16,19)(H,14,15,18) |
| InChIKey | LGRDZNGBZZREEK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|