C13H20N6 — CID 105362857
5,6-diethyl-N-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazin-3-amine (PubChem CID 105362857) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5,6-diethyl-N-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362857 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 5,6-diethyl-N-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCCCc2ncc[nH]2)nc1CC |
| InChI | InChI=1S/C13H20N6/c1-3-10-11(4-2)18-19-13(17-10)16-7-5-6-12-14-8-9-15-12/h8-9H,3-7H2,1-2H3,(H,14,15)(H,16,17,19) |
| InChIKey | OTVYCIIZMMEGMH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|