C11H16N4 — CID 105362658
N-but-3-ynyl-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 105362658) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-but-3-ynyl-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-but-3-ynyl-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362658 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-but-3-ynyl-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | C#CCCNc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C11H16N4/c1-4-7-8-12-11-13-9(5-2)10(6-3)14-15-11/h1H,5-8H2,2-3H3,(H,12,13,15) |
| InChIKey | FOQHCPSLHMQQCF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|