C15H20N4O — CID 105362499
4-[2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]ethyl]phenol (PubChem CID 105362499) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 105362499 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[2-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]ethyl]phenol |
| SMILES | CCc1nnc(NCCc2ccc(O)cc2)nc1CC |
| InChI | InChI=1S/C15H20N4O/c1-3-13-14(4-2)18-19-15(17-13)16-10-9-11-5-7-12(20)8-6-11/h5-8,20H,3-4,9-10H2,1-2H3,(H,16,17,19) |
| InChIKey | NUCLZWNOGDEMRI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |