C14H16N4O2 — CID 114388199
N-(5,6-diethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide (PubChem CID 114388199) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-(5,6-diethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide.
| Compound Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 114388199 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-4-hydroxybenzamide |
| SMILES | CCc1nnc(NC(=O)c2ccc(O)cc2)nc1CC |
| InChI | InChI=1S/C14H16N4O2/c1-3-11-12(4-2)17-18-14(15-11)16-13(20)9-5-7-10(19)8-6-9/h5-8,19H,3-4H2,1-2H3,(H,15,16,18,20) |
| InChIKey | BUWOVVZULXFXKH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |