C13H13BrClN5O — CID 114387307
5-bromo-2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyridine-3-carboxamide (PubChem CID 114387307) has the molecular formula C13H13BrClN5O and a molecular weight of 370.64 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114387307 |
| Molecular Formula | C13H13BrClN5O |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 5-bromo-2-chloro-N-(5,6-diethyl-1,2,4-triazin-3-yl)pyridine-3-carboxamide |
| SMILES | CCc1nnc(NC(=O)c2cc(Br)cnc2Cl)nc1CC |
| InChI | InChI=1S/C13H13BrClN5O/c1-3-9-10(4-2)19-20-13(17-9)18-12(21)8-5-7(14)6-16-11(8)15/h5-6H,3-4H2,1-2H3,(H,17,18,20,21) |
| InChIKey | YWJCJYWZGYCRIE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|