C10H17N5O — CID 105362431
3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propanamide (PubChem CID 105362431) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propanamide.
| Compound Name | 3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 105362431 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propanamide |
| SMILES | CCc1nnc(NCCC(N)=O)nc1CC |
| InChI | InChI=1S/C10H17N5O/c1-3-7-8(4-2)14-15-10(13-7)12-6-5-9(11)16/h3-6H2,1-2H3,(H2,11,16)(H,12,13,15) |
| InChIKey | STXBBMWUWSTXKK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |