C15H28N4 — CID 105362763
5,6-diethyl-N-octyl-1,2,4-triazin-3-amine (PubChem CID 105362763) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is 5,6-diethyl-N-octyl-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-octyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362763 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 5,6-diethyl-N-octyl-1,2,4-triazin-3-amine |
| SMILES | CCCCCCCCNc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C15H28N4/c1-4-7-8-9-10-11-12-16-15-17-13(5-2)14(6-3)18-19-15/h4-12H2,1-3H3,(H,16,17,19) |
| InChIKey | LNGYXKIIRGYFRZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|