C15H29N5S — CID 110192063
N-dodecyl-6-methylsulfanyl-1,2,4,5-tetrazin-3-amine (PubChem CID 110192063) has the molecular formula C15H29N5S and a molecular weight of 311.50 g/mol. Its IUPAC name is N-dodecyl-6-methylsulfanyl-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-dodecyl-6-methylsulfanyl-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 110192063 |
| Molecular Formula | C15H29N5S |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N-dodecyl-6-methylsulfanyl-1,2,4,5-tetrazin-3-amine |
| SMILES | CCCCCCCCCCCCNc1nnc(SC)nn1 |
| InChI | InChI=1S/C15H29N5S/c1-3-4-5-6-7-8-9-10-11-12-13-16-14-17-19-15(21-2)20-18-14/h3-13H2,1-2H3,(H,16,17,18) |
| InChIKey | DHJMZMCRNKIMIY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|