C20H38N4S2 — CID 19935568
4,6-bis(hexylsulfanyl)-N-pentyl-1,3,5-triazin-2-amine (PubChem CID 19935568) has the molecular formula C20H38N4S2 and a molecular weight of 398.69 g/mol. Its IUPAC name is 4,6-bis(hexylsulfanyl)-N-pentyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(hexylsulfanyl)-N-pentyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 19935568 |
| Molecular Formula | C20H38N4S2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 4,6-bis(hexylsulfanyl)-N-pentyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCSc1nc(NCCCCC)nc(SCCCCCC)n1 |
| InChI | InChI=1S/C20H38N4S2/c1-4-7-10-13-16-25-19-22-18(21-15-12-9-6-3)23-20(24-19)26-17-14-11-8-5-2/h4-17H2,1-3H3,(H,21,22,23,24) |
| InChIKey | AYNXTNAJRRTWRV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|