C12H21ClN4S — CID 167281206
4-chloro-N-methyl-6-octylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 167281206) has the molecular formula C12H21ClN4S and a molecular weight of 288.85 g/mol. Its IUPAC name is 4-chloro-N-methyl-6-octylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-methyl-6-octylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 167281206 |
| Molecular Formula | C12H21ClN4S |
| Molecular Weight | 288.85 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-chloro-N-methyl-6-octylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCCCSc1nc(Cl)nc(NC)n1 |
| InChI | InChI=1S/C12H21ClN4S/c1-3-4-5-6-7-8-9-18-12-16-10(13)15-11(14-2)17-12/h3-9H2,1-2H3,(H,14,15,16,17) |
| InChIKey | ZBYOPCHPBSRWJN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|