C21H38ClN3OS2 — CID 164898661
8-[(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)sulfanyl]octan-1-ol (PubChem CID 164898661) has the molecular formula C21H38ClN3OS2 and a molecular weight of 448.14 g/mol. Its IUPAC name is 8-[(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)sulfanyl]octan-1-ol.
| Compound Name | 8-[(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)sulfanyl]octan-1-ol |
|---|---|
| PubChem CID | 164898661 |
| Molecular Formula | C21H38ClN3OS2 |
| Molecular Weight | 448.14 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 8-[(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)sulfanyl]octan-1-ol |
| SMILES | CCCCCCCCCCSc1nc(Cl)nc(SCCCCCCCCO)n1 |
| InChI | InChI=1S/C21H38ClN3OS2/c1-2-3-4-5-6-8-11-14-17-27-20-23-19(22)24-21(25-20)28-18-15-12-9-7-10-13-16-26/h26H,2-18H2,1H3 |
| InChIKey | NBMUURDUPXDIFI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.14 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|