C21H35Cl2N3S — CID 163547885
2,4-dichloro-6-[(Z)-octadec-9-enyl]sulfanyl-1,3,5-triazine (PubChem CID 163547885) has the molecular formula C21H35Cl2N3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2,4-dichloro-6-[(Z)-octadec-9-enyl]sulfanyl-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-[(Z)-octadec-9-enyl]sulfanyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163547885 |
| Molecular Formula | C21H35Cl2N3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2,4-dichloro-6-[(Z)-octadec-9-enyl]sulfanyl-1,3,5-triazine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCSc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C21H35Cl2N3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-27-21-25-19(22)24-20(23)26-21/h9-10H,2-8,11-18H2,1H3/b10-9- |
| InChIKey | FGPFPTQSIAPAPA-KTKRTIGZSA-N |
| XLogP | 8.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|