C21H37ClN4O2S — CID 157483893
tert-butyl N-[3-(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)propyl]carbamate (PubChem CID 157483893) has the molecular formula C21H37ClN4O2S and a molecular weight of 445.07 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 157483893 |
| Molecular Formula | C21H37ClN4O2S |
| Molecular Weight | 445.07 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-6-decylsulfanyl-1,3,5-triazin-2-yl)propyl]carbamate |
| SMILES | CCCCCCCCCCSc1nc(Cl)nc(CCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C21H37ClN4O2S/c1-5-6-7-8-9-10-11-12-16-29-19-25-17(24-18(22)26-19)14-13-15-23-20(27)28-21(2,3)4/h5-16H2,1-4H3,(H,23,27) |
| InChIKey | IHWDVLXDBCSYGQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.07 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|