C30H48N4O3S2 — CID 130218254
[4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]phenyl] tert-butyl carbonate (PubChem CID 130218254) has the molecular formula C30H48N4O3S2 and a molecular weight of 576.87 g/mol. Its IUPAC name is [4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]phenyl] tert-butyl carbonate.
| Compound Name | [4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 130218254 |
| Molecular Formula | C30H48N4O3S2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | [4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]phenyl] tert-butyl carbonate |
| SMILES | CCCCCCCCSc1nc(Nc2ccc(OC(=O)OC(C)(C)C)cc2)nc(SCCCCCCCC)n1 |
| InChI | InChI=1S/C30H48N4O3S2/c1-6-8-10-12-14-16-22-38-27-32-26(33-28(34-27)39-23-17-15-13-11-9-7-2)31-24-18-20-25(21-19-24)36-29(35)37-30(3,4)5/h18-21H,6-17,22-23H2,1-5H3,(H,31,32,33,34) |
| InChIKey | USZROYHUIZQOHR-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|