C45H80N4OS2 — CID 20531337
4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-2,6-bis(2-methylnonan-2-yl)phenol (PubChem CID 20531337) has the molecular formula C45H80N4OS2 and a molecular weight of 757.30 g/mol. Its IUPAC name is 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-2,6-bis(2-methylnonan-2-yl)phenol.
| Compound Name | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-2,6-bis(2-methylnonan-2-yl)phenol |
|---|---|
| PubChem CID | 20531337 |
| Molecular Formula | C45H80N4OS2 |
| Molecular Weight | 757.30 g/mol |
| Exact Mass | 756.58 |
| IUPAC Name | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-2,6-bis(2-methylnonan-2-yl)phenol |
| SMILES | CCCCCCCCSc1nc(Nc2cc(C(C)(C)CCCCCCC)c(O)c(C(C)(C)CCCCCCC)c2)nc(SCCCCCCCC)n1 |
| InChI | InChI=1S/C45H80N4OS2/c1-9-13-17-21-25-29-33-51-42-47-41(48-43(49-42)52-34-30-26-22-18-14-10-2)46-37-35-38(44(5,6)31-27-23-19-15-11-3)40(50)39(36-37)45(7,8)32-28-24-20-16-12-4/h35-36,50H,9-34H2,1-8H3,(H,46,47,48,49) |
| InChIKey | QAZMKKCNLFVWRT-UHFFFAOYSA-N |
| XLogP | 15.50 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.30 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|