C75H123N3O6 — CID 139806116
1,3,5-tris[1-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 139806116) has the molecular formula C75H123N3O6 and a molecular weight of 1162.82 g/mol. Its IUPAC name is 1,3,5-tris[1-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[1-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139806116 |
| Molecular Formula | C75H123N3O6 |
| Molecular Weight | 1162.82 g/mol |
| Exact Mass | 1161.94 |
| IUPAC Name | 1,3,5-tris[1-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCCC(C)(C)c1cc(C(C)n2c(=O)n(C(C)c3cc(C(C)(C)CCCCC)c(O)c(C(C)(C)CCCCC)c3)c(=O)n(C(C)c3cc(C(C)(C)CCCCC)c(O)c(C(C)(C)CCCCC)c3)c2=O)cc(C(C)(C)CCCCC)c1O |
| InChI | InChI=1S/C75H123N3O6/c1-22-28-34-40-70(10,11)58-46-55(47-59(64(58)79)71(12,13)41-35-29-23-2)52(7)76-67(82)77(53(8)56-48-60(72(14,15)42-36-30-24-3)65(80)61(49-56)73(16,17)43-37-31-25-4)69(84)78(68(76)83)54(9)57-50-62(74(18,19)44-38-32-26-5)66(81)63(51-57)75(20,21)45-39-33-27-6/h46-54,79-81H,22-45H2,1-21H3 |
| InChIKey | NHDRKJFWQYLPEY-UHFFFAOYSA-N |
| XLogP | 20.26 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1162.82 |
| LogP ≤ 5 | 20.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|