C52H86O2S — CID 21488253
4-[6-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]-9-thiabicyclo[3.3.1]nonan-2-yl]-2,6-bis(2-methylheptan-2-yl)phenol (PubChem CID 21488253) has the molecular formula C52H86O2S and a molecular weight of 775.32 g/mol. Its IUPAC name is 4-[6-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]-9-thiabicyclo[3.3.1]nonan-2-yl]-2,6-bis(2-methylheptan-2-yl)phenol.
| Compound Name | 4-[6-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]-9-thiabicyclo[3.3.1]nonan-2-yl]-2,6-bis(2-methylheptan-2-yl)phenol |
|---|---|
| PubChem CID | 21488253 |
| Molecular Formula | C52H86O2S |
| Molecular Weight | 775.32 g/mol |
| Exact Mass | 774.63 |
| IUPAC Name | 4-[6-[4-hydroxy-3,5-bis(2-methylheptan-2-yl)phenyl]-9-thiabicyclo[3.3.1]nonan-2-yl]-2,6-bis(2-methylheptan-2-yl)phenol |
| SMILES | CCCCCC(C)(C)c1cc(C2CCC3SC2CCC3c2cc(C(C)(C)CCCCC)c(O)c(C(C)(C)CCCCC)c2)cc(C(C)(C)CCCCC)c1O |
| InChI | InChI=1S/C52H86O2S/c1-13-17-21-29-49(5,6)41-33-37(34-42(47(41)53)50(7,8)30-22-18-14-2)39-25-27-46-40(26-28-45(39)55-46)38-35-43(51(9,10)31-23-19-15-3)48(54)44(36-38)52(11,12)32-24-20-16-4/h33-36,39-40,45-46,53-54H,13-32H2,1-12H3 |
| InChIKey | ONMIIOVNZOZHIB-UHFFFAOYSA-N |
| XLogP | 16.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.32 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|