C34H58N4OS2 — CID 87339267
4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-methylamino]-2,6-ditert-butylphenol (PubChem CID 87339267) has the molecular formula C34H58N4OS2 and a molecular weight of 603.00 g/mol. Its IUPAC name is 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-methylamino]-2,6-ditert-butylphenol.
| Compound Name | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-methylamino]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 87339267 |
| Molecular Formula | C34H58N4OS2 |
| Molecular Weight | 603.00 g/mol |
| Exact Mass | 602.41 |
| IUPAC Name | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-methylamino]-2,6-ditert-butylphenol |
| SMILES | CCCCCCCCSc1nc(SCCCCCCCC)nc(N(C)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C34H58N4OS2/c1-10-12-14-16-18-20-22-40-31-35-30(36-32(37-31)41-23-21-19-17-15-13-11-2)38(9)26-24-27(33(3,4)5)29(39)28(25-26)34(6,7)8/h24-25,39H,10-23H2,1-9H3 |
| InChIKey | MBRDORHYBPICAQ-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.00 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|