C35H58N4OS2 — CID 146459270
4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-cyclohexylamino]-2-tert-butylphenol (PubChem CID 146459270) has the molecular formula C35H58N4OS2 and a molecular weight of 615.01 g/mol. Its IUPAC name is 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-cyclohexylamino]-2-tert-butylphenol.
| Compound Name | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-cyclohexylamino]-2-tert-butylphenol |
|---|---|
| PubChem CID | 146459270 |
| Molecular Formula | C35H58N4OS2 |
| Molecular Weight | 615.01 g/mol |
| Exact Mass | 614.41 |
| IUPAC Name | 4-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-cyclohexylamino]-2-tert-butylphenol |
| SMILES | CCCCCCCCSc1nc(SCCCCCCCC)nc(N(c2ccc(O)c(C(C)(C)C)c2)C2CCCCC2)n1 |
| InChI | InChI=1S/C35H58N4OS2/c1-6-8-10-12-14-19-25-41-33-36-32(37-34(38-33)42-26-20-15-13-11-9-7-2)39(28-21-17-16-18-22-28)29-23-24-31(40)30(27-29)35(3,4)5/h23-24,27-28,40H,6-22,25-26H2,1-5H3 |
| InChIKey | DJTKBHPJYNPYJR-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.01 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|