C20H37N5S — CID 19935567
2-N-cyclobutyl-4-N-octyl-6-pentylsulfanyl-1,3,5-triazine-2,4-diamine (PubChem CID 19935567) has the molecular formula C20H37N5S and a molecular weight of 379.62 g/mol. Its IUPAC name is 2-N-cyclobutyl-4-N-octyl-6-pentylsulfanyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-cyclobutyl-4-N-octyl-6-pentylsulfanyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19935567 |
| Molecular Formula | C20H37N5S |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 2-N-cyclobutyl-4-N-octyl-6-pentylsulfanyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCNc1nc(NC2CCC2)nc(SCCCCC)n1 |
| InChI | InChI=1S/C20H37N5S/c1-3-5-7-8-9-10-15-21-18-23-19(22-17-13-12-14-17)25-20(24-18)26-16-11-6-4-2/h17H,3-16H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | PJYRDZVUMJAYDN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|