C17H32N6S — CID 140514462
4-N-heptyl-2-N-(4-methylsulfanylcyclohexyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 140514462) has the molecular formula C17H32N6S and a molecular weight of 352.55 g/mol. Its IUPAC name is 4-N-heptyl-2-N-(4-methylsulfanylcyclohexyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-heptyl-2-N-(4-methylsulfanylcyclohexyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 140514462 |
| Molecular Formula | C17H32N6S |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-N-heptyl-2-N-(4-methylsulfanylcyclohexyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCNc1nc(N)nc(NC2CCC(SC)CC2)n1 |
| InChI | InChI=1S/C17H32N6S/c1-3-4-5-6-7-12-19-16-21-15(18)22-17(23-16)20-13-8-10-14(24-2)11-9-13/h13-14H,3-12H2,1-2H3,(H4,18,19,20,21,22,23) |
| InChIKey | TZAACWDXTGVDSC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|