C7H15N7 — CID 25242682
2-N-butyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine (PubChem CID 25242682) has the molecular formula C7H15N7 and a molecular weight of 197.25 g/mol. Its IUPAC name is 2-N-butyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25242682 |
| Molecular Formula | C7H15N7 |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-N-butyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(NN)n1 |
| InChI | InChI=1S/C7H15N7/c1-2-3-4-10-6-11-5(8)12-7(13-6)14-9/h2-4,9H2,1H3,(H4,8,10,11,12,13,14) |
| InChIKey | OENJKSIJKLDQEZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|